C10H21NOS — CID 146940638
methyl-methylidene-oxo-(4-propan-2-ylpiperidin-1-yl)-λ6-sulfane (PubChem CID 146940638) has the molecular formula C10H21NOS and a molecular weight of 203.35 g/mol. Its IUPAC name is methyl-methylidene-oxo-(4-propan-2-ylpiperidin-1-yl)-λ6-sulfane.
| Compound Name | methyl-methylidene-oxo-(4-propan-2-ylpiperidin-1-yl)-λ6-sulfane |
|---|---|
| PubChem CID | 146940638 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | methyl-methylidene-oxo-(4-propan-2-ylpiperidin-1-yl)-λ6-sulfane |
| SMILES | C=S(C)(=O)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C10H21NOS/c1-9(2)10-5-7-11(8-6-10)13(3,4)12/h9-10H,3,5-8H2,1-2,4H3 |
| InChIKey | AGUMEGOOPJKFPP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|