C18H19NOS2 — CID 14696269
N-[3-[5-[(E)-2-(1-benzothiophen-2-yl)ethenyl]thiophen-2-yl]propyl]-N-methylhydroxylamine (PubChem CID 14696269) has the molecular formula C18H19NOS2 and a molecular weight of 329.49 g/mol. Its IUPAC name is N-[3-[5-[(E)-2-(1-benzothiophen-2-yl)ethenyl]thiophen-2-yl]propyl]-N-methylhydroxylamine.
| Compound Name | N-[3-[5-[(E)-2-(1-benzothiophen-2-yl)ethenyl]thiophen-2-yl]propyl]-N-methylhydroxylamine |
|---|---|
| PubChem CID | 14696269 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-[3-[5-[(E)-2-(1-benzothiophen-2-yl)ethenyl]thiophen-2-yl]propyl]-N-methylhydroxylamine |
| SMILES | CN(O)CCCc1ccc(/C=C/c2cc3ccccc3s2)s1 |
| InChI | InChI=1S/C18H19NOS2/c1-19(20)12-4-6-15-8-9-16(21-15)10-11-17-13-14-5-2-3-7-18(14)22-17/h2-3,5,7-11,13,20H,4,6,12H2,1H3/b11-10+ |
| InChIKey | OYNKBGDWDJYWMX-ZHACJKMWSA-N |
| XLogP | 5.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|