C12H19N2O+ — CID 146969644
[3-(2,3-dihydro-1H-inden-2-ylamino)-2-hydroxypropyl]azanium (PubChem CID 146969644) has the molecular formula C12H19N2O+ and a molecular weight of 207.30 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-inden-2-ylamino)-2-hydroxypropyl]azanium.
| Compound Name | [3-(2,3-dihydro-1H-inden-2-ylamino)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 146969644 |
| Molecular Formula | C12H19N2O+ |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | [3-(2,3-dihydro-1H-inden-2-ylamino)-2-hydroxypropyl]azanium |
| SMILES | [NH3+]CC(O)CNC1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H18N2O/c13-7-12(15)8-14-11-5-9-3-1-2-4-10(9)6-11/h1-4,11-12,14-15H,5-8,13H2/p+1 |
| InChIKey | AMEDQWPXXOORMC-UHFFFAOYSA-O |
| XLogP | -0.65 |
| TPSA | 59.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |