C21H19Cl2NO2 — CID 146979641
2-chloro-1-[1-(4-chlorophenyl)-2-methyl-6-(oxetan-3-ylmethyl)indol-3-yl]ethanone (PubChem CID 146979641) has the molecular formula C21H19Cl2NO2 and a molecular weight of 388.29 g/mol. Its IUPAC name is 2-chloro-1-[1-(4-chlorophenyl)-2-methyl-6-(oxetan-3-ylmethyl)indol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[1-(4-chlorophenyl)-2-methyl-6-(oxetan-3-ylmethyl)indol-3-yl]ethanone |
|---|---|
| PubChem CID | 146979641 |
| Molecular Formula | C21H19Cl2NO2 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-chloro-1-[1-(4-chlorophenyl)-2-methyl-6-(oxetan-3-ylmethyl)indol-3-yl]ethanone |
| SMILES | Cc1c(C(=O)CCl)c2ccc(CC3COC3)cc2n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2NO2/c1-13-21(20(25)10-22)18-7-2-14(8-15-11-26-12-15)9-19(18)24(13)17-5-3-16(23)4-6-17/h2-7,9,15H,8,10-12H2,1H3 |
| InChIKey | AOBBUUMHPUCYHD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|