C27H30N6O3 — CID 146979882
methyl N-[(2S)-1-[(2S)-2-[4-[4-(4-azidophenyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 146979882) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S)-2-[4-[4-(4-azidophenyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S)-2-[4-[4-(4-azidophenyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 146979882 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | methyl N-[(2S)-1-[(2S)-2-[4-[4-(4-azidophenyl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(-c3ccc(N=[N+]=[N-])cc3)cc2)C1)C(C)C |
| InChI | InChI=1S/C27H30N6O3/c1-17(2)25(30-27(35)36-3)26(34)33-14-4-5-24(33)23-15-21(16-29-23)20-8-6-18(7-9-20)19-10-12-22(13-11-19)31-32-28/h6-13,16-17,24-25H,4-5,14-15H2,1-3H3,(H,30,35)/t24-,25-/m0/s1 |
| InChIKey | AOCHPPDBQVUHRG-DQEYMECFSA-N |
| XLogP | 5.85 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|