C19H24N6O3 — CID 58348453
methyl N-[(2S)-1-[(2S)-2-(5-azido-3H-indol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 58348453) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S)-2-(5-azido-3H-indol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S)-2-(5-azido-3H-indol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58348453 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | methyl N-[(2S)-1-[(2S)-2-(5-azido-3H-indol-2-yl)pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C1=Nc2ccc(N=[N+]=[N-])cc2C1)C(C)C |
| InChI | InChI=1S/C19H24N6O3/c1-11(2)17(22-19(27)28-3)18(26)25-8-4-5-16(25)15-10-12-9-13(23-24-20)6-7-14(12)21-15/h6-7,9,11,16-17H,4-5,8,10H2,1-3H3,(H,22,27)/t16-,17-/m0/s1 |
| InChIKey | YCQSEFRHSKKYKW-IRXDYDNUSA-N |
| XLogP | 3.63 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|