C28H44BN3O5 — CID 123191066
methyl N-[3-methyl-1-[2-[N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-C-propylcarbonimidoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 123191066) has the molecular formula C28H44BN3O5 and a molecular weight of 513.49 g/mol. Its IUPAC name is methyl N-[3-methyl-1-[2-[N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-C-propylcarbonimidoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-[2-[N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-C-propylcarbonimidoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 123191066 |
| Molecular Formula | C28H44BN3O5 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | methyl N-[3-methyl-1-[2-[N-[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-C-propylcarbonimidoyl]pyrrolidin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | CCC/C(=N\c1cc(B2OC(C)(C)C(C)(C)O2)ccc1C)C1CCCN1C(=O)C(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C28H44BN3O5/c1-10-12-21(23-13-11-16-32(23)25(33)24(18(2)3)31-26(34)35-9)30-22-17-20(15-14-19(22)4)29-36-27(5,6)28(7,8)37-29/h14-15,17-18,23-24H,10-13,16H2,1-9H3,(H,31,34)/b30-21+ |
| InChIKey | HNSCQRPDEKIBBI-MWAVMZGNSA-N |
| XLogP | 4.54 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|