C22H25F2IN4O5 — CID 146983476
[3-[4-[difluoro(iodo)methyl]phenyl]-5-[3-(oxetan-3-yloxy)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-morpholin-4-ylmethanone (PubChem CID 146983476) has the molecular formula C22H25F2IN4O5 and a molecular weight of 590.37 g/mol. Its IUPAC name is [3-[4-[difluoro(iodo)methyl]phenyl]-5-[3-(oxetan-3-yloxy)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [3-[4-[difluoro(iodo)methyl]phenyl]-5-[3-(oxetan-3-yloxy)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 146983476 |
| Molecular Formula | C22H25F2IN4O5 |
| Molecular Weight | 590.37 g/mol |
| Exact Mass | 590.08 |
| IUPAC Name | [3-[4-[difluoro(iodo)methyl]phenyl]-5-[3-(oxetan-3-yloxy)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CC(c2ccc(C(F)(F)I)cc2)CC(c2nc(OC3COC3)no2)C1 |
| InChI | InChI=1S/C22H25F2IN4O5/c23-22(24,25)17-3-1-14(2-4-17)15-9-16(19-26-20(27-34-19)33-18-12-32-13-18)11-29(10-15)21(30)28-5-7-31-8-6-28/h1-4,15-16,18H,5-13H2 |
| InChIKey | AOTWASPLPJNIJD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|