C23H29F3N4O6S — CID 58116477
(1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(2-methoxyethoxy)-1,2,4-oxadiazol-5-yl]-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]methanone (PubChem CID 58116477) has the molecular formula C23H29F3N4O6S and a molecular weight of 546.57 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(2-methoxyethoxy)-1,2,4-oxadiazol-5-yl]-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(2-methoxyethoxy)-1,2,4-oxadiazol-5-yl]-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 58116477 |
| Molecular Formula | C23H29F3N4O6S |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-[3-[3-(2-methoxyethoxy)-1,2,4-oxadiazol-5-yl]-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]methanone |
| SMILES | COCCOc1noc(C2CC(c3ccc(CC(F)(F)F)cc3)CN(C(=O)N3CCS(=O)(=O)CC3)C2)n1 |
| InChI | InChI=1S/C23H29F3N4O6S/c1-34-8-9-35-21-27-20(36-28-21)19-12-18(17-4-2-16(3-5-17)13-23(24,25)26)14-30(15-19)22(31)29-6-10-37(32,33)11-7-29/h2-5,18-19H,6-15H2,1H3 |
| InChIKey | RSXVYMAKVBPKFE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|