C23H29F3N4O4S — CID 68761648
[3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]-(1,1-dihydroxy-1,4-thiazinan-4-yl)methanone (PubChem CID 68761648) has the molecular formula C23H29F3N4O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is [3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]-(1,1-dihydroxy-1,4-thiazinan-4-yl)methanone.
| Compound Name | [3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]-(1,1-dihydroxy-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 68761648 |
| Molecular Formula | C23H29F3N4O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [3-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-5-[4-(2,2,2-trifluoroethyl)phenyl]piperidin-1-yl]-(1,1-dihydroxy-1,4-thiazinan-4-yl)methanone |
| SMILES | O=C(N1CCS(O)(O)CC1)N1CC(c2ccc(CC(F)(F)F)cc2)CC(c2nc(C3CC3)no2)C1 |
| InChI | InChI=1S/C23H29F3N4O4S/c24-23(25,26)12-15-1-3-16(4-2-15)18-11-19(21-27-20(28-34-21)17-5-6-17)14-30(13-18)22(31)29-7-9-35(32,33)10-8-29/h1-4,17-19,32-33H,5-14H2 |
| InChIKey | SRNCDPLHLGXOPC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |