C21H30N2O — CID 146984887
(3aR,6aS)-N-(2-but-1-en-2-yl-6-propylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 146984887) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (3aR,6aS)-N-(2-but-1-en-2-yl-6-propylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3aR,6aS)-N-(2-but-1-en-2-yl-6-propylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146984887 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (3aR,6aS)-N-(2-but-1-en-2-yl-6-propylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | C=C(CC)c1cccc(CCC)c1NC(=O)C1NC[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C21H30N2O/c1-4-8-15-9-6-11-17(14(3)5-2)19(15)23-21(24)20-18-12-7-10-16(18)13-22-20/h6,9,11,16,18,20,22H,3-5,7-8,10,12-13H2,1-2H3,(H,23,24)/t16-,18-,20?/m1/s1 |
| InChIKey | APARPQUVGFMWAX-PGBVBIMESA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |