C16H23ClN2O — CID 174853204
N-(2,6-dimethylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide;hydrochloride (PubChem CID 174853204) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide;hydrochloride.
| Compound Name | N-(2,6-dimethylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 174853204 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(2,6-dimethylphenyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)C1NCC2CCCC21.Cl |
| InChI | InChI=1S/C16H22N2O.ClH/c1-10-5-3-6-11(2)14(10)18-16(19)15-13-8-4-7-12(13)9-17-15;/h3,5-6,12-13,15,17H,4,7-9H2,1-2H3,(H,18,19);1H |
| InChIKey | QDACWVOTBIVISZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |