C16H22N4O2 — CID 14698571
(E)-1-(4-butoxyphenyl)-N-propan-2-yloxy-1-(1,2,4-triazol-1-yl)methanimine (PubChem CID 14698571) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (E)-1-(4-butoxyphenyl)-N-propan-2-yloxy-1-(1,2,4-triazol-1-yl)methanimine.
| Compound Name | (E)-1-(4-butoxyphenyl)-N-propan-2-yloxy-1-(1,2,4-triazol-1-yl)methanimine |
|---|---|
| PubChem CID | 14698571 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (E)-1-(4-butoxyphenyl)-N-propan-2-yloxy-1-(1,2,4-triazol-1-yl)methanimine |
| SMILES | CCCCOc1ccc(/C(=N\OC(C)C)n2cncn2)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-4-5-10-21-15-8-6-14(7-9-15)16(19-22-13(2)3)20-12-17-11-18-20/h6-9,11-13H,4-5,10H2,1-3H3/b19-16+ |
| InChIKey | KGIBMDHRLLRHQJ-KNTRCKAVSA-N |
| XLogP | 3.09 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|