C34H49N11O4S — CID 146993139
3-amino-N'-[6-tert-butylsulfonyl-7-[3-[4-[5-[(3R)-3-methylpiperazin-1-yl]pyrazine-2-carbonyl]piperazin-1-yl]propoxy]quinazolin-4-yl]-2-methylbut-2-enimidamide (PubChem CID 146993139) has the molecular formula C34H49N11O4S and a molecular weight of 707.91 g/mol. Its IUPAC name is 3-amino-N'-[6-tert-butylsulfonyl-7-[3-[4-[5-[(3R)-3-methylpiperazin-1-yl]pyrazine-2-carbonyl]piperazin-1-yl]propoxy]quinazolin-4-yl]-2-methylbut-2-enimidamide.
| Compound Name | 3-amino-N'-[6-tert-butylsulfonyl-7-[3-[4-[5-[(3R)-3-methylpiperazin-1-yl]pyrazine-2-carbonyl]piperazin-1-yl]propoxy]quinazolin-4-yl]-2-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 146993139 |
| Molecular Formula | C34H49N11O4S |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | 3-amino-N'-[6-tert-butylsulfonyl-7-[3-[4-[5-[(3R)-3-methylpiperazin-1-yl]pyrazine-2-carbonyl]piperazin-1-yl]propoxy]quinazolin-4-yl]-2-methylbut-2-enimidamide |
| SMILES | CC(N)=C(C)/C(N)=N/c1ncnc2cc(OCCCN3CCN(C(=O)c4cnc(N5CCN[C@H](C)C5)cn4)CC3)c(S(=O)(=O)C(C)(C)C)cc12 |
| InChI | InChI=1S/C34H49N11O4S/c1-22-20-45(10-8-37-22)30-19-38-27(18-39-30)33(46)44-13-11-43(12-14-44)9-7-15-49-28-17-26-25(16-29(28)50(47,48)34(4,5)6)32(41-21-40-26)42-31(36)23(2)24(3)35/h16-19,21-22,37H,7-15,20,35H2,1-6H3,(H2,36,40,41,42)/t22-/m1/s1 |
| InChIKey | PNVGWNMHGDMQNM-JOCHJYFZSA-N |
| XLogP | 2.26 |
| TPSA | 198.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|