C19H15ClFN3O2 — CID 146999471
(3S)-1-(3-chloro-4-isocyanophenyl)-4-(5-fluoroindazol-2-yl)-3-hydroxy-3-methylbutan-2-one (PubChem CID 146999471) has the molecular formula C19H15ClFN3O2 and a molecular weight of 371.80 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5-fluoroindazol-2-yl)-3-hydroxy-3-methylbutan-2-one.
| Compound Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5-fluoroindazol-2-yl)-3-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 146999471 |
| Molecular Formula | C19H15ClFN3O2 |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(5-fluoroindazol-2-yl)-3-hydroxy-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2cc3cc(F)ccc3n2)cc1Cl |
| InChI | InChI=1S/C19H15ClFN3O2/c1-19(26,11-24-10-13-9-14(21)4-6-16(13)23-24)18(25)8-12-3-5-17(22-2)15(20)7-12/h3-7,9-10,26H,8,11H2,1H3/t19-/m0/s1 |
| InChIKey | ARTDQXYQSGHWQP-IBGZPJMESA-N |
| XLogP | 3.94 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|