C21H22F6N4O — CID 147011747
3-[4-[2-(aminomethyl)phenyl]piperazin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]oxiran-2-amine (PubChem CID 147011747) has the molecular formula C21H22F6N4O and a molecular weight of 460.42 g/mol. Its IUPAC name is 3-[4-[2-(aminomethyl)phenyl]piperazin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]oxiran-2-amine.
| Compound Name | 3-[4-[2-(aminomethyl)phenyl]piperazin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]oxiran-2-amine |
|---|---|
| PubChem CID | 147011747 |
| Molecular Formula | C21H22F6N4O |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-[4-[2-(aminomethyl)phenyl]piperazin-1-yl]-N-[3,5-bis(trifluoromethyl)phenyl]oxiran-2-amine |
| SMILES | NCc1ccccc1N1CCN(C2OC2Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H22F6N4O/c22-20(23,24)14-9-15(21(25,26)27)11-16(10-14)29-18-19(32-18)31-7-5-30(6-8-31)17-4-2-1-3-13(17)12-28/h1-4,9-11,18-19,29H,5-8,12,28H2 |
| InChIKey | ATZNQPMZEVLKCJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|