C26H23BrN8OS — CID 147013638
1-(5-bromo-2-methoxyphenyl)-3-[3-[1-methyl-4-(pyridin-3-ylmethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]thiourea (PubChem CID 147013638) has the molecular formula C26H23BrN8OS and a molecular weight of 575.50 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-3-[3-[1-methyl-4-(pyridin-3-ylmethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]thiourea.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-3-[3-[1-methyl-4-(pyridin-3-ylmethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 147013638 |
| Molecular Formula | C26H23BrN8OS |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-3-[3-[1-methyl-4-(pyridin-3-ylmethylamino)pyrazolo[3,4-d]pyrimidin-6-yl]phenyl]thiourea |
| SMILES | COc1ccc(Br)cc1NC(=S)Nc1cccc(-c2nc(NCc3cccnc3)c3cnn(C)c3n2)c1 |
| InChI | InChI=1S/C26H23BrN8OS/c1-35-25-20(15-30-35)24(29-14-16-5-4-10-28-13-16)33-23(34-25)17-6-3-7-19(11-17)31-26(37)32-21-12-18(27)8-9-22(21)36-2/h3-13,15H,14H2,1-2H3,(H,29,33,34)(H2,31,32,37) |
| InChIKey | AUIVBRWPNDNAML-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 101.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|