C21H22N6 — CID 70732300
1-methyl-N-(4-phenylbutyl)-6-pyridin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 70732300) has the molecular formula C21H22N6 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-methyl-N-(4-phenylbutyl)-6-pyridin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-N-(4-phenylbutyl)-6-pyridin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 70732300 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-methyl-N-(4-phenylbutyl)-6-pyridin-3-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCCCCc3ccccc3)nc(-c3cccnc3)nc21 |
| InChI | InChI=1S/C21H22N6/c1-27-21-18(15-24-27)20(25-19(26-21)17-11-7-12-22-14-17)23-13-6-5-10-16-8-3-2-4-9-16/h2-4,7-9,11-12,14-15H,5-6,10,13H2,1H3,(H,23,25,26) |
| InChIKey | UIQBHXKGDLSNTR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|