C19H24N6O — CID 95882613
1-methyl-N-[4-[(2R)-oxolan-2-yl]butyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 95882613) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-methyl-N-[4-[(2R)-oxolan-2-yl]butyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-N-[4-[(2R)-oxolan-2-yl]butyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95882613 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-methyl-N-[4-[(2R)-oxolan-2-yl]butyl]-6-pyridin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCCCC[C@@H]3CCCO3)nc(-c3ccncc3)nc21 |
| InChI | InChI=1S/C19H24N6O/c1-25-19-16(13-22-25)18(21-9-3-2-5-15-6-4-12-26-15)23-17(24-19)14-7-10-20-11-8-14/h7-8,10-11,13,15H,2-6,9,12H2,1H3,(H,21,23,24)/t15-/m1/s1 |
| InChIKey | XXFNZCJAQOCBGS-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|