C17H22N6 — CID 56890560
1-methyl-6-propan-2-yl-N-(3-pyridin-4-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 56890560) has the molecular formula C17H22N6 and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-methyl-6-propan-2-yl-N-(3-pyridin-4-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-6-propan-2-yl-N-(3-pyridin-4-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56890560 |
| Molecular Formula | C17H22N6 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 1-methyl-6-propan-2-yl-N-(3-pyridin-4-ylpropyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CC(C)c1nc(NCCCc2ccncc2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C17H22N6/c1-12(2)15-21-16(14-11-20-23(3)17(14)22-15)19-8-4-5-13-6-9-18-10-7-13/h6-7,9-12H,4-5,8H2,1-3H3,(H,19,21,22) |
| InChIKey | YBJODVHPXGQEHH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|