C13H17F6N — CID 147016799
1-(cyclohexen-1-yl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 147016799) has the molecular formula C13H17F6N and a molecular weight of 301.27 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(cyclohexen-1-yl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 147016799 |
| Molecular Formula | C13H17F6N |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CC(C(F)(F)F)CN(C2=CCCCC2)C1 |
| InChI | InChI=1S/C13H17F6N/c14-12(15,16)9-6-10(13(17,18)19)8-20(7-9)11-4-2-1-3-5-11/h4,9-10H,1-3,5-8H2 |
| InChIKey | AUXWWRKLMJPFGD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |