C30H36FN5O3 — CID 147022635
4-fluoro-N-[6-[(3-oxopiperazin-1-yl)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide (PubChem CID 147022635) has the molecular formula C30H36FN5O3 and a molecular weight of 533.65 g/mol. Its IUPAC name is 4-fluoro-N-[6-[(3-oxopiperazin-1-yl)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide.
| Compound Name | 4-fluoro-N-[6-[(3-oxopiperazin-1-yl)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 147022635 |
| Molecular Formula | C30H36FN5O3 |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 4-fluoro-N-[6-[(3-oxopiperazin-1-yl)methyl]-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide |
| SMILES | CC(C)NC(=O)C1CCC(N2/C(=N/C(=O)c3ccc(F)cc3)Cc3ccc(CN4CCNC(=O)C4)cc32)CC1 |
| InChI | InChI=1S/C30H36FN5O3/c1-19(2)33-29(38)22-7-11-25(12-8-22)36-26-15-20(17-35-14-13-32-28(37)18-35)3-4-23(26)16-27(36)34-30(39)21-5-9-24(31)10-6-21/h3-6,9-10,15,19,22,25H,7-8,11-14,16-18H2,1-2H3,(H,32,37)(H,33,38)/b34-27+ |
| InChIKey | AVZZRZLDSZGODV-DNGXXSEMSA-N |
| XLogP | 3.44 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|