C25H24N2O3S — CID 147036147
5-[2-[2-[4-(benzylsulfonylmethyl)phenyl]ethoxy]phenyl]-1H-imidazole (PubChem CID 147036147) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 5-[2-[2-[4-(benzylsulfonylmethyl)phenyl]ethoxy]phenyl]-1H-imidazole.
| Compound Name | 5-[2-[2-[4-(benzylsulfonylmethyl)phenyl]ethoxy]phenyl]-1H-imidazole |
|---|---|
| PubChem CID | 147036147 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 5-[2-[2-[4-(benzylsulfonylmethyl)phenyl]ethoxy]phenyl]-1H-imidazole |
| SMILES | O=S(=O)(Cc1ccccc1)Cc1ccc(CCOc2ccccc2-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c28-31(29,17-21-6-2-1-3-7-21)18-22-12-10-20(11-13-22)14-15-30-25-9-5-4-8-23(25)24-16-26-19-27-24/h1-13,16,19H,14-15,17-18H2,(H,26,27) |
| InChIKey | AYNSOYZWYHHDOA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |