C26H24N2OS — CID 159392368
1-[4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-phenylpropane-2-thione (PubChem CID 159392368) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-[4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-phenylpropane-2-thione.
| Compound Name | 1-[4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-phenylpropane-2-thione |
|---|---|
| PubChem CID | 159392368 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[4-[2-[2-(1H-imidazol-5-yl)phenoxy]ethyl]phenyl]-3-phenylpropane-2-thione |
| SMILES | S=C(Cc1ccccc1)Cc1ccc(CCOc2ccccc2-c2cnc[nH]2)cc1 |
| InChI | InChI=1S/C26H24N2OS/c30-23(16-21-6-2-1-3-7-21)17-22-12-10-20(11-13-22)14-15-29-26-9-5-4-8-24(26)25-18-27-19-28-25/h1-13,18-19H,14-17H2,(H,27,28) |
| InChIKey | LMGWZCBRSSGMBO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|