C10H14N3O+ — CID 147046205
3,4,5-trimethyl-2-(1H-pyrazol-4-ylmethyl)-1,2-oxazol-2-ium (PubChem CID 147046205) has the molecular formula C10H14N3O+ and a molecular weight of 192.24 g/mol. Its IUPAC name is 3,4,5-trimethyl-2-(1H-pyrazol-4-ylmethyl)-1,2-oxazol-2-ium.
| Compound Name | 3,4,5-trimethyl-2-(1H-pyrazol-4-ylmethyl)-1,2-oxazol-2-ium |
|---|---|
| PubChem CID | 147046205 |
| Molecular Formula | C10H14N3O+ |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3,4,5-trimethyl-2-(1H-pyrazol-4-ylmethyl)-1,2-oxazol-2-ium |
| SMILES | Cc1o[n+](Cc2cn[nH]c2)c(C)c1C |
| InChI | InChI=1S/C10H14N3O/c1-7-8(2)13(14-9(7)3)6-10-4-11-12-5-10/h4-5H,6H2,1-3H3,(H,11,12)/q+1 |
| InChIKey | FBBIRACJWDUVIH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 45.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|