C15H10F4N2O — CID 147053435
6-ethyl-2-(3-fluorophenoxy)-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 147053435) has the molecular formula C15H10F4N2O and a molecular weight of 310.25 g/mol. Its IUPAC name is 6-ethyl-2-(3-fluorophenoxy)-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 6-ethyl-2-(3-fluorophenoxy)-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 147053435 |
| Molecular Formula | C15H10F4N2O |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 6-ethyl-2-(3-fluorophenoxy)-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCc1cc(C(F)(F)F)c(C#N)c(Oc2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H10F4N2O/c1-2-10-7-13(15(17,18)19)12(8-20)14(21-10)22-11-5-3-4-9(16)6-11/h3-7H,2H2,1H3 |
| InChIKey | BBTQAFFWDLWMIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |