C20H19ClF2N2O5 — CID 147065707
2-[4-[2-(1-amino-4,4-difluoro-3-oxobut-1-enyl)-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]butanoic acid (PubChem CID 147065707) has the molecular formula C20H19ClF2N2O5 and a molecular weight of 440.83 g/mol. Its IUPAC name is 2-[4-[2-(1-amino-4,4-difluoro-3-oxobut-1-enyl)-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]butanoic acid.
| Compound Name | 2-[4-[2-(1-amino-4,4-difluoro-3-oxobut-1-enyl)-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 147065707 |
| Molecular Formula | C20H19ClF2N2O5 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-[4-[2-(1-amino-4,4-difluoro-3-oxobut-1-enyl)-5-chlorophenyl]-5-methoxy-2-oxo-1-pyridinyl]butanoic acid |
| SMILES | CCC(C(=O)O)n1cc(OC)c(-c2cc(Cl)ccc2C(N)=CC(=O)C(F)F)cc1=O |
| InChI | InChI=1S/C20H19ClF2N2O5/c1-3-15(20(28)29)25-9-17(30-2)13(7-18(25)27)12-6-10(21)4-5-11(12)14(24)8-16(26)19(22)23/h4-9,15,19H,3,24H2,1-2H3,(H,28,29) |
| InChIKey | LPFNRYJLVKJEFK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|