C27H35N3O3 — CID 147070708
[3-butyl-5-(1H-indol-3-ylmethoxy)phenyl] 4-piperazin-1-ylbutanoate (PubChem CID 147070708) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is [3-butyl-5-(1H-indol-3-ylmethoxy)phenyl] 4-piperazin-1-ylbutanoate.
| Compound Name | [3-butyl-5-(1H-indol-3-ylmethoxy)phenyl] 4-piperazin-1-ylbutanoate |
|---|---|
| PubChem CID | 147070708 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | [3-butyl-5-(1H-indol-3-ylmethoxy)phenyl] 4-piperazin-1-ylbutanoate |
| SMILES | CCCCc1cc(OCc2c[nH]c3ccccc23)cc(OC(=O)CCCN2CCNCC2)c1 |
| InChI | InChI=1S/C27H35N3O3/c1-2-3-7-21-16-23(32-20-22-19-29-26-9-5-4-8-25(22)26)18-24(17-21)33-27(31)10-6-13-30-14-11-28-12-15-30/h4-5,8-9,16-19,28-29H,2-3,6-7,10-15,20H2,1H3 |
| InChIKey | BEZMGIJBXAQONB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|