C23H32ClN3O2 — CID 119390993
2-[3-[(2-methylphenyl)methoxy]phenyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride (PubChem CID 119390993) has the molecular formula C23H32ClN3O2 and a molecular weight of 417.98 g/mol. Its IUPAC name is 2-[3-[(2-methylphenyl)methoxy]phenyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride.
| Compound Name | 2-[3-[(2-methylphenyl)methoxy]phenyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119390993 |
| Molecular Formula | C23H32ClN3O2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[3-[(2-methylphenyl)methoxy]phenyl]-N-(3-piperazin-1-ylpropyl)acetamide;hydrochloride |
| SMILES | Cc1ccccc1COc1cccc(CC(=O)NCCCN2CCNCC2)c1.Cl |
| InChI | InChI=1S/C23H31N3O2.ClH/c1-19-6-2-3-8-21(19)18-28-22-9-4-7-20(16-22)17-23(27)25-10-5-13-26-14-11-24-12-15-26;/h2-4,6-9,16,24H,5,10-15,17-18H2,1H3,(H,25,27);1H |
| InChIKey | NLSWKJKLVSREOZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|