C19H25N3O3 — CID 119393656
3-(phenoxymethyl)-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide (PubChem CID 119393656) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide.
| Compound Name | 3-(phenoxymethyl)-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 119393656 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 3-(phenoxymethyl)-N-(3-piperazin-1-ylpropyl)furan-2-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c23-19(21-8-4-11-22-12-9-20-10-13-22)18-16(7-14-24-18)15-25-17-5-2-1-3-6-17/h1-3,5-7,14,20H,4,8-13,15H2,(H,21,23) |
| InChIKey | IVMKGVOMESXGSU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|