C15H15NO3 — CID 46689866
3-(phenoxymethyl)-N-prop-2-enylfuran-2-carboxamide (PubChem CID 46689866) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N-prop-2-enylfuran-2-carboxamide.
| Compound Name | 3-(phenoxymethyl)-N-prop-2-enylfuran-2-carboxamide |
|---|---|
| PubChem CID | 46689866 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-(phenoxymethyl)-N-prop-2-enylfuran-2-carboxamide |
| SMILES | C=CCNC(=O)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C15H15NO3/c1-2-9-16-15(17)14-12(8-10-18-14)11-19-13-6-4-3-5-7-13/h2-8,10H,1,9,11H2,(H,16,17) |
| InChIKey | OEALCEWDEFLHOB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|