C17H15NO3S — CID 30138155
3-(phenoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide (PubChem CID 30138155) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-(phenoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide.
| Compound Name | 3-(phenoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 30138155 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 3-(phenoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(NCc1cccs1)c1occc1COc1ccccc1 |
| InChI | InChI=1S/C17H15NO3S/c19-17(18-11-15-7-4-10-22-15)16-13(8-9-20-16)12-21-14-5-2-1-3-6-14/h1-10H,11-12H2,(H,18,19) |
| InChIKey | YNHXJTIPHWLMPS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |