C21H21NO4 — CID 46487559
N-[[3-(methoxymethyl)phenyl]methyl]-3-(phenoxymethyl)furan-2-carboxamide (PubChem CID 46487559) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[[3-(methoxymethyl)phenyl]methyl]-3-(phenoxymethyl)furan-2-carboxamide.
| Compound Name | N-[[3-(methoxymethyl)phenyl]methyl]-3-(phenoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 46487559 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[[3-(methoxymethyl)phenyl]methyl]-3-(phenoxymethyl)furan-2-carboxamide |
| SMILES | COCc1cccc(CNC(=O)c2occc2COc2ccccc2)c1 |
| InChI | InChI=1S/C21H21NO4/c1-24-14-17-7-5-6-16(12-17)13-22-21(23)20-18(10-11-25-20)15-26-19-8-3-2-4-9-19/h2-12H,13-15H2,1H3,(H,22,23) |
| InChIKey | YPWNHLJKCWQUSN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |