C21H20N2O6S — CID 42204645
[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 3-(phenoxymethyl)furan-2-carboxylate (PubChem CID 42204645) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 3-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 3-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 42204645 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 3-(phenoxymethyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1occc1COc1ccccc1)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C21H20N2O6S/c24-18(23-21(26)22-10-8-17-7-4-12-30-17)14-29-20(25)19-15(9-11-27-19)13-28-16-5-2-1-3-6-16/h1-7,9,11-12H,8,10,13-14H2,(H2,22,23,24,26) |
| InChIKey | DHHWDIOMRSHPTR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |