C25H14I3O3S2+ — CID 147072348
[4-(10-oxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate (PubChem CID 147072348) has the molecular formula C25H14I3O3S2+ and a molecular weight of 807.23 g/mol. Its IUPAC name is [4-(10-oxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate.
| Compound Name | [4-(10-oxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 147072348 |
| Molecular Formula | C25H14I3O3S2+ |
| Molecular Weight | 807.23 g/mol |
| Exact Mass | 806.75 |
| IUPAC Name | [4-(10-oxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate |
| SMILES | O=C(Oc1ccc([S+]2c3ccccc3S(=O)c3ccccc32)cc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C25H14I3O3S2/c26-17-13-14-18(27)24(28)23(17)25(29)31-15-9-11-16(12-10-15)32-19-5-1-3-7-21(19)33(30)22-8-4-2-6-20(22)32/h1-14H/q+1 |
| InChIKey | BFHHTMLBDDAZSH-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.23 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|