C25H14F2I3O2S+ — CID 153464105
bis(4-fluorophenyl)-[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium (PubChem CID 153464105) has the molecular formula C25H14F2I3O2S+ and a molecular weight of 797.16 g/mol. Its IUPAC name is bis(4-fluorophenyl)-[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium.
| Compound Name | bis(4-fluorophenyl)-[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium |
|---|---|
| PubChem CID | 153464105 |
| Molecular Formula | C25H14F2I3O2S+ |
| Molecular Weight | 797.16 g/mol |
| Exact Mass | 796.78 |
| IUPAC Name | bis(4-fluorophenyl)-[4-(2,4,6-triiodophenoxy)carbonylphenyl]sulfanium |
| SMILES | O=C(Oc1c(I)cc(I)cc1I)c1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H14F2I3O2S/c26-16-3-9-20(10-4-16)33(21-11-5-17(27)6-12-21)19-7-1-15(2-8-19)25(31)32-24-22(29)13-18(28)14-23(24)30/h1-14H/q+1 |
| InChIKey | HNARAWUYWHPOEM-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.16 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|