C20H14F2O5S — CID 22081625
[4-(4-methoxyphenyl)sulfonylphenyl] 2,5-difluorobenzoate (PubChem CID 22081625) has the molecular formula C20H14F2O5S and a molecular weight of 404.39 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)sulfonylphenyl] 2,5-difluorobenzoate.
| Compound Name | [4-(4-methoxyphenyl)sulfonylphenyl] 2,5-difluorobenzoate |
|---|---|
| PubChem CID | 22081625 |
| Molecular Formula | C20H14F2O5S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | [4-(4-methoxyphenyl)sulfonylphenyl] 2,5-difluorobenzoate |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(OC(=O)c3cc(F)ccc3F)cc2)cc1 |
| InChI | InChI=1S/C20H14F2O5S/c1-26-14-3-7-16(8-4-14)28(24,25)17-9-5-15(6-10-17)27-20(23)18-12-13(21)2-11-19(18)22/h2-12H,1H3 |
| InChIKey | UPIIFJKJRPDKEY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|