C21H13F3O4S — CID 91711887
[2-(2-phenylsulfanylacetyl)oxyphenyl] 2,3,4-trifluorobenzoate (PubChem CID 91711887) has the molecular formula C21H13F3O4S and a molecular weight of 418.39 g/mol. Its IUPAC name is [2-(2-phenylsulfanylacetyl)oxyphenyl] 2,3,4-trifluorobenzoate.
| Compound Name | [2-(2-phenylsulfanylacetyl)oxyphenyl] 2,3,4-trifluorobenzoate |
|---|---|
| PubChem CID | 91711887 |
| Molecular Formula | C21H13F3O4S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [2-(2-phenylsulfanylacetyl)oxyphenyl] 2,3,4-trifluorobenzoate |
| SMILES | O=C(CSc1ccccc1)Oc1ccccc1OC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H13F3O4S/c22-15-11-10-14(19(23)20(15)24)21(26)28-17-9-5-4-8-16(17)27-18(25)12-29-13-6-2-1-3-7-13/h1-11H,12H2 |
| InChIKey | IHJYTUSWMJJONT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|