C16H11F5O3S — CID 91721147
2-(2,3,4,5,6-pentafluorophenoxy)ethyl 3-methylsulfanylbenzoate (PubChem CID 91721147) has the molecular formula C16H11F5O3S and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 3-methylsulfanylbenzoate.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 3-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 91721147 |
| Molecular Formula | C16H11F5O3S |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenoxy)ethyl 3-methylsulfanylbenzoate |
| SMILES | CSc1cccc(C(=O)OCCOc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H11F5O3S/c1-25-9-4-2-3-8(7-9)16(22)24-6-5-23-15-13(20)11(18)10(17)12(19)14(15)21/h2-4,7H,5-6H2,1H3 |
| InChIKey | IBYFVLGCBXUHNB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|