About N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide
N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide (PubChem CID 147075477) has the molecular formula C17H13BrF3N3O
and a molecular weight of 412.21 g/mol. Its IUPAC name is N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide |
| PubChem CID | 147075477 |
| Molecular Formula | C17H13BrF3N3O |
| Molecular Weight | 412.21 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)Nc1cccc(-n2cnc3cc(Br)ccc32)c1 |
| InChI | InChI=1S/C17H13BrF3N3O/c18-11-4-5-15-14(8-11)22-10-24(15)13-3-1-2-12(9-13)23-16(25)6-7-17(19,20)21/h1-5,8-10H,6-7H2,(H,23,25) |
| InChIKey | BFWLRDUBYTYKDX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.21 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide?
The IUPAC name of N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide (CID 147075477) is N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide?
The canonical SMILES for N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide is O=C(CCC(F)(F)F)Nc1cccc(-n2cnc3cc(Br)ccc32)c1.
What is the InChIKey of N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide?
The InChIKey is BFWLRDUBYTYKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BrF3N3O/c18-11-4-5-15-14(8-11)22-10-24(15)13-3-1-2-12(9-13)23-16(25)6-7-17(19,20)21/h1-5,8-10H,6-7H2,(H,23,25).
What are the key properties of N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide?
N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide has a molecular weight of 412.21 g/mol, XLogP of 5.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(5-bromobenzimidazol-1-yl)phenyl]-4,4,4-trifluorobutanamide is sourced from PubChem (CID 147075477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).