C17H14N4O — CID 168521648
2-cyano-N-[1-(3-methylphenyl)benzimidazol-5-yl]acetamide (PubChem CID 168521648) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-cyano-N-[1-(3-methylphenyl)benzimidazol-5-yl]acetamide.
| Compound Name | 2-cyano-N-[1-(3-methylphenyl)benzimidazol-5-yl]acetamide |
|---|---|
| PubChem CID | 168521648 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-cyano-N-[1-(3-methylphenyl)benzimidazol-5-yl]acetamide |
| SMILES | Cc1cccc(-n2cnc3cc(NC(=O)CC#N)ccc32)c1 |
| InChI | InChI=1S/C17H14N4O/c1-12-3-2-4-14(9-12)21-11-19-15-10-13(5-6-16(15)21)20-17(22)7-8-18/h2-6,9-11H,7H2,1H3,(H,20,22) |
| InChIKey | GBNVGNRSHVXZEL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |