C23H29N3O — CID 3614186
1-(3-methylphenyl)-N-octylbenzimidazole-5-carboxamide (PubChem CID 3614186) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-octylbenzimidazole-5-carboxamide.
| Compound Name | 1-(3-methylphenyl)-N-octylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3614186 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-(3-methylphenyl)-N-octylbenzimidazole-5-carboxamide |
| SMILES | CCCCCCCCNC(=O)c1ccc2c(c1)ncn2-c1cccc(C)c1 |
| InChI | InChI=1S/C23H29N3O/c1-3-4-5-6-7-8-14-24-23(27)19-12-13-22-21(16-19)25-17-26(22)20-11-9-10-18(2)15-20/h9-13,15-17H,3-8,14H2,1-2H3,(H,24,27) |
| InChIKey | QZYFJMWBCUVBGU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|