C7H15NO — CID 147080628
1,3,3-trimethylpyrrolidin-2-ol (PubChem CID 147080628) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is 1,3,3-trimethylpyrrolidin-2-ol.
| Compound Name | 1,3,3-trimethylpyrrolidin-2-ol |
|---|---|
| PubChem CID | 147080628 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1,3,3-trimethylpyrrolidin-2-ol |
| SMILES | CN1CCC(C)(C)C1O |
| InChI | InChI=1S/C7H15NO/c1-7(2)4-5-8(3)6(7)9/h6,9H,4-5H2,1-3H3 |
| InChIKey | BGVMLDAMFGZUTK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |