C16H20N4O4S2 — CID 147089342
(2S)-N-[3-(hydroxyamino)-3-oxopropyl]-4-oxo-2-propan-2-yl-4-[2-(1,3-thiazol-4-yl)-1,3-thiazol-4-yl]butanamide (PubChem CID 147089342) has the molecular formula C16H20N4O4S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S)-N-[3-(hydroxyamino)-3-oxopropyl]-4-oxo-2-propan-2-yl-4-[2-(1,3-thiazol-4-yl)-1,3-thiazol-4-yl]butanamide.
| Compound Name | (2S)-N-[3-(hydroxyamino)-3-oxopropyl]-4-oxo-2-propan-2-yl-4-[2-(1,3-thiazol-4-yl)-1,3-thiazol-4-yl]butanamide |
|---|---|
| PubChem CID | 147089342 |
| Molecular Formula | C16H20N4O4S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (2S)-N-[3-(hydroxyamino)-3-oxopropyl]-4-oxo-2-propan-2-yl-4-[2-(1,3-thiazol-4-yl)-1,3-thiazol-4-yl]butanamide |
| SMILES | CC(C)[C@H](CC(=O)c1csc(-c2cscn2)n1)C(=O)NCCC(=O)NO |
| InChI | InChI=1S/C16H20N4O4S2/c1-9(2)10(15(23)17-4-3-14(22)20-24)5-13(21)11-7-26-16(19-11)12-6-25-8-18-12/h6-10,24H,3-5H2,1-2H3,(H,17,23)(H,20,22)/t10-/m0/s1 |
| InChIKey | BIMJAEUGMCRYMJ-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|