C18H24N4O4S2 — CID 148625996
(2S)-N-[4-(hydroxyamino)-4-oxobutyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-4-oxo-2-propan-2-ylbutanamide (PubChem CID 148625996) has the molecular formula C18H24N4O4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is (2S)-N-[4-(hydroxyamino)-4-oxobutyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-4-oxo-2-propan-2-ylbutanamide.
| Compound Name | (2S)-N-[4-(hydroxyamino)-4-oxobutyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-4-oxo-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 148625996 |
| Molecular Formula | C18H24N4O4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (2S)-N-[4-(hydroxyamino)-4-oxobutyl]-4-[2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-4-oxo-2-propan-2-ylbutanamide |
| SMILES | Cc1nc(-c2nc(C(=O)C[C@H](C(=O)NCCCC(=O)NO)C(C)C)cs2)cs1 |
| InChI | InChI=1S/C18H24N4O4S2/c1-10(2)12(17(25)19-6-4-5-16(24)22-26)7-15(23)13-8-28-18(21-13)14-9-27-11(3)20-14/h8-10,12,26H,4-7H2,1-3H3,(H,19,25)(H,22,24)/t12-/m0/s1 |
| InChIKey | NHFDJAQZRZAMNQ-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|