C31H33N5O2 — CID 147115561
3-methanimidoyl-11-oxo-8-(4-pyrrolidin-1-ylpiperidin-1-yl)spiro[5H-benzo[b]carbazole-6,4'-oxane]-9-carbonitrile (PubChem CID 147115561) has the molecular formula C31H33N5O2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 3-methanimidoyl-11-oxo-8-(4-pyrrolidin-1-ylpiperidin-1-yl)spiro[5H-benzo[b]carbazole-6,4'-oxane]-9-carbonitrile.
| Compound Name | 3-methanimidoyl-11-oxo-8-(4-pyrrolidin-1-ylpiperidin-1-yl)spiro[5H-benzo[b]carbazole-6,4'-oxane]-9-carbonitrile |
|---|---|
| PubChem CID | 147115561 |
| Molecular Formula | C31H33N5O2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 3-methanimidoyl-11-oxo-8-(4-pyrrolidin-1-ylpiperidin-1-yl)spiro[5H-benzo[b]carbazole-6,4'-oxane]-9-carbonitrile |
| SMILES | [H]/N=C/c1ccc2c3c([nH]c2c1)C1(CCOCC1)c1cc(N2CCC(N4CCCC4)CC2)c(C#N)cc1C3=O |
| InChI | InChI=1S/C31H33N5O2/c32-18-20-3-4-23-26(15-20)34-30-28(23)29(37)24-16-21(19-33)27(17-25(24)31(30)7-13-38-14-8-31)36-11-5-22(6-12-36)35-9-1-2-10-35/h3-4,15-18,22,32,34H,1-2,5-14H2/b32-18+ |
| InChIKey | BNIRMQCLHAWPFD-KCSSXMTESA-N |
| XLogP | 4.74 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|