About 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile
9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile (PubChem CID 66834709) has the molecular formula C22H17BrN2O3
and a molecular weight of 437.29 g/mol. Its IUPAC name is 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile.
Molecular Properties
| Compound Name | 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
| PubChem CID | 66834709 |
| Molecular Formula | C22H17BrN2O3 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 436.04 |
| IUPAC Name | 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
| SMILES | COc1cc2c(cc1Br)C(=O)c1c([nH]c3cc(C#N)ccc13)C21CCOCC1 |
| InChI | InChI=1S/C22H17BrN2O3/c1-27-18-10-15-14(9-16(18)23)20(26)19-13-3-2-12(11-24)8-17(13)25-21(19)22(15)4-6-28-7-5-22/h2-3,8-10,25H,4-7H2,1H3 |
| InChIKey | RTJNVACFOSFTSH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The IUPAC name of 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile (CID 66834709) is 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile.
What is the SMILES notation for 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The canonical SMILES for 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile is COc1cc2c(cc1Br)C(=O)c1c([nH]c3cc(C#N)ccc13)C21CCOCC1.
What is the InChIKey of 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
The InChIKey is RTJNVACFOSFTSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17BrN2O3/c1-27-18-10-15-14(9-16(18)23)20(26)19-13-3-2-12(11-24)8-17(13)25-21(19)22(15)4-6-28-7-5-22/h2-3,8-10,25H,4-7H2,1H3.
What are the key properties of 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile?
9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile has a molecular weight of 437.29 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromo-8-methoxy-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile is sourced from PubChem (CID 66834709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).