About 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile
7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile (PubChem CID 149389991) has the molecular formula C23H20BrNO2
and a molecular weight of 422.32 g/mol. Its IUPAC name is 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile.
Molecular Properties
| Compound Name | 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile |
| PubChem CID | 149389991 |
| Molecular Formula | C23H20BrNO2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile |
| SMILES | COc1cc2c(cc1Br)CC1=C(Cc3cc(C#N)ccc31)C21CCOCC1 |
| InChI | InChI=1S/C23H20BrNO2/c1-26-22-12-19-16(11-21(22)24)9-18-17-3-2-14(13-25)8-15(17)10-20(18)23(19)4-6-27-7-5-23/h2-3,8,11-12H,4-7,9-10H2,1H3 |
| InChIKey | YNIGOXRWWIOXDQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile?
The IUPAC name of 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile (CID 149389991) is 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile.
What is the SMILES notation for 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile?
The canonical SMILES for 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile is COc1cc2c(cc1Br)CC1=C(Cc3cc(C#N)ccc31)C21CCOCC1.
What is the InChIKey of 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile?
The InChIKey is YNIGOXRWWIOXDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20BrNO2/c1-26-22-12-19-16(11-21(22)24)9-18-17-3-2-14(13-25)8-15(17)10-20(18)23(19)4-6-27-7-5-23/h2-3,8,11-12H,4-7,9-10H2,1H3.
What are the key properties of 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile?
7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile has a molecular weight of 422.32 g/mol, XLogP of 4.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-8-methoxyspiro[5,11-dihydrobenzo[b]fluorene-10,4'-oxane]-2-carbonitrile is sourced from PubChem (CID 149389991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).