C23H19BrN2O3 — CID 125498118
8-(2-bromoethoxy)-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile (PubChem CID 125498118) has the molecular formula C23H19BrN2O3 and a molecular weight of 451.32 g/mol. Its IUPAC name is 8-(2-bromoethoxy)-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile.
| Compound Name | 8-(2-bromoethoxy)-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
|---|---|
| PubChem CID | 125498118 |
| Molecular Formula | C23H19BrN2O3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 8-(2-bromoethoxy)-11-oxospiro[5H-benzo[b]carbazole-6,4'-oxane]-3-carbonitrile |
| SMILES | N#Cc1ccc2c3c([nH]c2c1)C1(CCOCC1)c1cc(OCCBr)ccc1C3=O |
| InChI | InChI=1S/C23H19BrN2O3/c24-7-10-29-15-2-4-16-18(12-15)23(5-8-28-9-6-23)22-20(21(16)27)17-3-1-14(13-25)11-19(17)26-22/h1-4,11-12,26H,5-10H2 |
| InChIKey | NRDWQSVBIRNPEK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|