C25H32ClN3O4 — CID 147117031
(4S)-N-[[2-chloro-5-(2-methoxyethoxy)phenyl]methyl]-N-cyclopropyl-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide (PubChem CID 147117031) has the molecular formula C25H32ClN3O4 and a molecular weight of 474.00 g/mol. Its IUPAC name is (4S)-N-[[2-chloro-5-(2-methoxyethoxy)phenyl]methyl]-N-cyclopropyl-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (4S)-N-[[2-chloro-5-(2-methoxyethoxy)phenyl]methyl]-N-cyclopropyl-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 147117031 |
| Molecular Formula | C25H32ClN3O4 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (4S)-N-[[2-chloro-5-(2-methoxyethoxy)phenyl]methyl]-N-cyclopropyl-4-(1-methyl-2-oxo-4-pyridinyl)piperidine-3-carboxamide |
| SMILES | COCCOc1ccc(Cl)c(CN(C(=O)C2CNCC[C@@H]2c2ccn(C)c(=O)c2)C2CC2)c1 |
| InChI | InChI=1S/C25H32ClN3O4/c1-28-10-8-17(14-24(28)30)21-7-9-27-15-22(21)25(31)29(19-3-4-19)16-18-13-20(5-6-23(18)26)33-12-11-32-2/h5-6,8,10,13-14,19,21-22,27H,3-4,7,9,11-12,15-16H2,1-2H3/t21-,22?/m1/s1 |
| InChIKey | BNPSUYFRQIHFCF-ZMFCMNQTSA-N |
| XLogP | 2.95 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|